CAS 1431867-39-8 is the registry number for Ticagrelor Impurity 163. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6-methoxy-5-nitro-2-propylsulfanylpyrimidine (CAS 1431867-39-8) is a chemical compound with the molecular formula C8H10ClN3O3S and a molecular weight of 263.70 g/mol. IUPAC name: 4-chloro-6-methoxy-5-nitro-2-propylsulfanylpyrimidine. InChIKey: JTSPCFODRZNLPO-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O3S |
|---|---|
| Molecular weight | 263.70 g/mol |
| IUPAC name | 4-chloro-6-methoxy-5-nitro-2-propylsulfanylpyrimidine |
| InChIKey | JTSPCFODRZNLPO-UHFFFAOYSA-N |
| SMILES | CCCSC1=NC(=C(C(=N1)Cl)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)