CAS 1431868-79-9 is the registry number for 2-(Pyrimidin-2-yl)-2,6-diazaspiro[3.3]heptane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-pyrimidin-2-yl-2,6-diazaspiro[3.3]heptane (CAS 1431868-79-9) is a chemical compound with the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. IUPAC name: 2-pyrimidin-2-yl-2,6-diazaspiro[3.3]heptane. InChIKey: LOXMGZLYIHYVLG-UHFFFAOYSA-N.
| Molecular formula | C9H12N4 |
|---|---|
| Molecular weight | 176.22 g/mol |
| IUPAC name | 2-pyrimidin-2-yl-2,6-diazaspiro[3.3]heptane |
| InChIKey | LOXMGZLYIHYVLG-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)C3=NC=CC=N3 |
Computed by PubChem (NCBI)