CAS 1431877-58-5 is the registry number for [1,2,4]Triazolo[1,5-a]pyridine-7-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[1,2,4]triazolo[1,5-a]pyridine-7-sulfonyl chloride (CAS 1431877-58-5) is a chemical compound with the molecular formula C6H4ClN3O2S and a molecular weight of 217.63 g/mol. IUPAC name: [1,2,4]triazolo[1,5-a]pyridine-7-sulfonyl chloride. InChIKey: VZVNQEXNQWNGSO-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3O2S |
|---|---|
| Molecular weight | 217.63 g/mol |
| IUPAC name | [1,2,4]triazolo[1,5-a]pyridine-7-sulfonyl chloride |
| InChIKey | VZVNQEXNQWNGSO-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC=N2)C=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)