CAS 1431953-77-3 appears in our catalog under these names: 2-(4-(3-Chloro-4-fluorophenyl)-5-oxo-4,5-dihydro-1h-1,2,4-triazol-3-yl)acetic acid, 95%, 2-(4-(3-Chloro-4-fluorophenyl)-5-oxo-4,5-dihydro-1H-1,2,4-triazol-3-yl)acetic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-[4-(3-chloro-4-fluorophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]acetic acid (CAS 1431953-77-3) is a chemical compound with the molecular formula C10H7ClFN3O3 and a molecular weight of 271.63 g/mol. IUPAC name: 2-[4-(3-chloro-4-fluorophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]acetic acid. InChIKey: FDYMFVXIXYQCGT-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFN3O3 |
|---|---|
| Molecular weight | 271.63 g/mol |
| IUPAC name | 2-[4-(3-chloro-4-fluorophenyl)-5-oxo-1H-1,2,4-triazol-3-yl]acetic acid |
| InChIKey | FDYMFVXIXYQCGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=NNC2=O)CC(=O)O)Cl)F |
Computed by PubChem (NCBI)