CAS 1431963-11-9 is the registry number for 3-(2,2-Difluoroethoxy)-1-methyl-1H-pyrazol-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,2-difluoroethoxy)-1-methylpyrazol-4-amine;hydrochloride (CAS 1431963-11-9) is a chemical compound with the molecular formula C6H10ClF2N3O and a molecular weight of 213.61 g/mol. IUPAC name: 3-(2,2-difluoroethoxy)-1-methylpyrazol-4-amine;hydrochloride. InChIKey: IKVWDZVPNRAFMC-UHFFFAOYSA-N.
| Molecular formula | C6H10ClF2N3O |
|---|---|
| Molecular weight | 213.61 g/mol |
| IUPAC name | 3-(2,2-difluoroethoxy)-1-methylpyrazol-4-amine;hydrochloride |
| InChIKey | IKVWDZVPNRAFMC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)OCC(F)F)N.Cl |
Computed by PubChem (NCBI)