CAS 1432059-11-4 is the registry number for 6-Bromopyrido[2,3-b]pyrazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4H-pyrido[2,3-b]pyrazin-3-one (CAS 1432059-11-4) is a chemical compound with the molecular formula C7H4BrN3O and a molecular weight of 226.03 g/mol. IUPAC name: 6-bromo-4H-pyrido[2,3-b]pyrazin-3-one. InChIKey: WOAXJTFCUCAEGQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 6-bromo-4H-pyrido[2,3-b]pyrazin-3-one |
| InChIKey | WOAXJTFCUCAEGQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=CC(=O)N2)Br |
Computed by PubChem (NCBI)