CAS 1432059-16-9 appears in our catalog under these names: Pyrazinamide-d3, Pyrazinamide-3,5,6-d3, 98 atom % D, min 98% Chemical Purity, Pyrazinamide-d3, 99.94%. Offered by: Chemat Brand, CDN, TRC, MedChemExpress. Available pack sizes: on request, 0,005g, 25mg, 1 mg.
3,5,6-trideuteriopyrazine-2-carboxamide (CAS 1432059-16-9) is a chemical compound with the molecular formula C5H5N3O and a molecular weight of 126.13 g/mol. IUPAC name: 3,5,6-trideuteriopyrazine-2-carboxamide. InChIKey: IPEHBUMCGVEMRF-CBYSEHNBSA-N.
| Molecular formula | C5H5N3O |
|---|---|
| Molecular weight | 126.13 g/mol |
| IUPAC name | 3,5,6-trideuteriopyrazine-2-carboxamide |
| InChIKey | IPEHBUMCGVEMRF-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(N=C(C(=N1)[2H])C(=O)N)[2H] |
Computed by PubChem (NCBI)