CAS 1432064-02-2 appears in our catalog under these names: Trifluoperazine-d3 DiHCl, Trifluoperazine-d3 Dihydrochloride, >95% (HPLC), Trifluoperazine–d3 (hydrochloride), Trifluoperazine-d3 hydrochloride, Trifluoperazine-d3 (dihydrochloride). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
10-[3-[4-(trideuteriomethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine (CAS 1432064-02-2) is a chemical compound with the molecular formula C21H24F3N3S and a molecular weight of 410.5 g/mol. IUPAC name: 10-[3-[4-(trideuteriomethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine. InChIKey: ZEWQUBUPAILYHI-FIBGUPNXSA-N.
| Molecular formula | C21H24F3N3S |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 10-[3-[4-(trideuteriomethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine |
| InChIKey | ZEWQUBUPAILYHI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)