Products 1432230-09-5
CAS 1432230-09-5 appears in our catalog under these names: (R)-Pramipexole-d3 Dihydrochloride, >95% (HPLC), Dexpramipexole–d3 dihydrochloride, (R)-Pramipexole-d3 dihydrochloride, Dexpramipexole-d3 (dihydrochloride). Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
(6R)-6-N-(3,3,3-trideuteriopropyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 1432230-09-5) is a chemical compound with the molecular formula C10H17N3S and a molecular weight of 214.35 g/mol. IUPAC name: (6R)-6-N-(3,3,3-trideuteriopropyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: FASDKYOPVNHBLU-ISLPBHIQSA-N.
| Molecular formula | C10H17N3S |
|---|---|
| Molecular weight | 214.35 g/mol |
| IUPAC name | (6R)-6-N-(3,3,3-trideuteriopropyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | FASDKYOPVNHBLU-ISLPBHIQSA-N |
| SMILES | [2H]C([2H])([2H])CCN[C@@H]1CCC2=C(C1)SC(=N2)N |
Computed by PubChem (NCBI)