CAS 1432312-58-7 is the registry number for 2,2,4-Trimethyl-1,2,3,4-tetrahydroquinoline-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,2,4-trimethyl-3,4-dihydro-1H-quinoline-6-carboxylic acid (CAS 1432312-58-7) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: 2,2,4-trimethyl-3,4-dihydro-1H-quinoline-6-carboxylic acid. InChIKey: QVFOSMHNHGVRJT-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 2,2,4-trimethyl-3,4-dihydro-1H-quinoline-6-carboxylic acid |
| InChIKey | QVFOSMHNHGVRJT-UHFFFAOYSA-N |
| SMILES | CC1CC(NC2=C1C=C(C=C2)C(=O)O)(C)C |
Computed by PubChem (NCBI)