CAS 143234-53-1 is the registry number for (S)-Ethyl 3,3,3-trifluoro-2-hydroxypropanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S)-3,3,3-trifluoro-2-hydroxypropanoate (CAS 143234-53-1) is a chemical compound with the molecular formula C5H7F3O3 and a molecular weight of 172.10 g/mol. IUPAC name: ethyl (2S)-3,3,3-trifluoro-2-hydroxypropanoate. InChIKey: SWCOLXVCLKJGEA-VKHMYHEASA-N.
| Molecular formula | C5H7F3O3 |
|---|---|
| Molecular weight | 172.10 g/mol |
| IUPAC name | ethyl (2S)-3,3,3-trifluoro-2-hydroxypropanoate |
| InChIKey | SWCOLXVCLKJGEA-VKHMYHEASA-N |
| SMILES | CCOC(=O)[C@@H](C(F)(F)F)O |
Computed by PubChem (NCBI)