CAS 143234-90-6 is the registry number for Gemcitabine impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxy-2,2-difluoro-3-oxopropyl] benzoate (CAS 143234-90-6) is a chemical compound with the molecular formula C17H20F2O6 and a molecular weight of 358.3 g/mol. IUPAC name: [(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxy-2,2-difluoro-3-oxopropyl] benzoate. InChIKey: OMWGKDXWCKGRHY-CHWSQXEVSA-N.
| Molecular formula | C17H20F2O6 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | [(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxy-2,2-difluoro-3-oxopropyl] benzoate |
| InChIKey | OMWGKDXWCKGRHY-CHWSQXEVSA-N |
| SMILES | CCOC(=O)C([C@@H]([C@H]1COC(O1)(C)C)OC(=O)C2=CC=CC=C2)(F)F |
Computed by PubChem (NCBI)