Products 1432499-51-8
CAS 1432499-51-8 is the registry number for ARI-3531. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R)-1-[(2S)-3-methyl-2-(pyridine-3-carbonylamino)butanoyl]pyrrolidin-2-yl]boronic acid (CAS 1432499-51-8) is a chemical compound with the molecular formula C15H22BN3O4 and a molecular weight of 319.17 g/mol. IUPAC name: [(2R)-1-[(2S)-3-methyl-2-(pyridine-3-carbonylamino)butanoyl]pyrrolidin-2-yl]boronic acid. InChIKey: QWMROLCIGVLHNY-STQMWFEESA-N.
| Molecular formula | C15H22BN3O4 |
|---|---|
| Molecular weight | 319.17 g/mol |
| IUPAC name | [(2R)-1-[(2S)-3-methyl-2-(pyridine-3-carbonylamino)butanoyl]pyrrolidin-2-yl]boronic acid |
| InChIKey | QWMROLCIGVLHNY-STQMWFEESA-N |
| SMILES | B([C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)C2=CN=CC=C2)(O)O |
Computed by PubChem (NCBI)