Products 1432592-04-5

CAS 1432592-04-5 is the registry number for 1,3-Dilinoleoyl-2-chloropropanediol. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 50 mg, 100 mg, 10 mg.

Structural formula: {0} (CAS {1})

[2-chloro-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate (CAS 1432592-04-5) is a chemical compound with the molecular formula C39H67ClO4 and a molecular weight of 635.4 g/mol. IUPAC name: [2-chloro-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate. InChIKey: JPFKFYGUGINXTE-MAZCIEHSSA-N.

Identity
Molecular formulaC39H67ClO4
Molecular weight635.4 g/mol
IUPAC name[2-chloro-3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-octadeca-9,12-dienoate
InChIKeyJPFKFYGUGINXTE-MAZCIEHSSA-N
SMILESCCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(Cl)COC(=O)CCCCCCC/C=C\C/C=C\CCCCC

Computed by PubChem (NCBI)