CAS 1432678-90-4 appears in our catalog under these names: 3-Bromo-1-{(3-(trifluoromethyl)phenyl)methyl}piperidin-2-one, 95%, 3-Bromo-1-{(3-(trifluoromethyl)phenyl)methyl}piperidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-bromo-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-2-one (CAS 1432678-90-4) is a chemical compound with the molecular formula C13H13BrF3NO and a molecular weight of 336.15 g/mol. IUPAC name: 3-bromo-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-2-one. InChIKey: FDIKSCCJXGNSJK-UHFFFAOYSA-N.
| Molecular formula | C13H13BrF3NO |
|---|---|
| Molecular weight | 336.15 g/mol |
| IUPAC name | 3-bromo-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-2-one |
| InChIKey | FDIKSCCJXGNSJK-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)CC2=CC(=CC=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)