CAS 1432678-93-7 appears in our catalog under these names: 3,5-Bis(difluoromethoxy)benzoic Acid, 3,5-Bis(difluoromethoxy)benzoic acid, 95%. Offered by: TRC, Biosynth, Fluorochem. Available pack sizes: 500mg, 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
3,5-bis(difluoromethoxy)benzoic acid (CAS 1432678-93-7) is a chemical compound with the molecular formula C9H6F4O4 and a molecular weight of 254.13 g/mol. IUPAC name: 3,5-bis(difluoromethoxy)benzoic acid. InChIKey: JLSSNDJBOJLEOV-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O4 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 3,5-bis(difluoromethoxy)benzoic acid |
| InChIKey | JLSSNDJBOJLEOV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)F)OC(F)F)C(=O)O |
Computed by PubChem (NCBI)