CAS 1432680-88-0 appears in our catalog under these names: 1-((Bromomethyl)sulfonyl)piperazine hydrochloride, 98%, 1-Bromomethanesulfonylpiperazine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 50mg.
1-(bromomethylsulfonyl)piperazine;hydrochloride (CAS 1432680-88-0) is a chemical compound with the molecular formula C5H12BrClN2O2S and a molecular weight of 279.58 g/mol. IUPAC name: 1-(bromomethylsulfonyl)piperazine;hydrochloride. InChIKey: CNVLJUDKJUEFKC-UHFFFAOYSA-N.
| Molecular formula | C5H12BrClN2O2S |
|---|---|
| Molecular weight | 279.58 g/mol |
| IUPAC name | 1-(bromomethylsulfonyl)piperazine;hydrochloride |
| InChIKey | CNVLJUDKJUEFKC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)CBr.Cl |
Computed by PubChem (NCBI)