CAS 1432681-32-7 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)-2,2-difluoroacetonitrile, 95%, 2-(3,4-Dichlorophenyl)-2,2-difluoroacetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(3,4-dichlorophenyl)-2,2-difluoroacetonitrile (CAS 1432681-32-7) is a chemical compound with the molecular formula C8H3Cl2F2N and a molecular weight of 222.02 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2,2-difluoroacetonitrile. InChIKey: RDWQDPNRXQBAEB-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F2N |
|---|---|
| Molecular weight | 222.02 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2,2-difluoroacetonitrile |
| InChIKey | RDWQDPNRXQBAEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C#N)(F)F)Cl)Cl |
Computed by PubChem (NCBI)