CAS 1432681-52-1 appears in our catalog under these names: 1,3-Diethyl 2-(4-bromo-2-fluorobenzoyl)propanedioate, 95%, 1,3-Diethyl 2-(4-bromo-2-fluorobenzoyl)propanedioate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Diethyl 2-(4-bromo-2-fluorobenzoyl)propanedioate (CAS 1432681-52-1) is a chemical compound with the molecular formula C14H14BrFO5 and a molecular weight of 361.16 g/mol. IUPAC name: diethyl 2-(4-bromo-2-fluorobenzoyl)propanedioate. InChIKey: WSYMSEUMLYZFLW-UHFFFAOYSA-N.
| Molecular formula | C14H14BrFO5 |
|---|---|
| Molecular weight | 361.16 g/mol |
| IUPAC name | diethyl 2-(4-bromo-2-fluorobenzoyl)propanedioate |
| InChIKey | WSYMSEUMLYZFLW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C1=C(C=C(C=C1)Br)F)C(=O)OCC |
Computed by PubChem (NCBI)