CAS 1432681-63-4 is the registry number for 2-(1H-1,2,4-Triazol-1-ylmethyl)benzene-1-sulfonyl chloride hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(1,2,4-triazol-1-ylmethyl)benzenesulfonyl chloride;hydrochloride (CAS 1432681-63-4) is a chemical compound with the molecular formula C9H9Cl2N3O2S and a molecular weight of 294.16 g/mol. IUPAC name: 2-(1,2,4-triazol-1-ylmethyl)benzenesulfonyl chloride;hydrochloride. InChIKey: HLGQFLDSIFZWGQ-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3O2S |
|---|---|
| Molecular weight | 294.16 g/mol |
| IUPAC name | 2-(1,2,4-triazol-1-ylmethyl)benzenesulfonyl chloride;hydrochloride |
| InChIKey | HLGQFLDSIFZWGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=NC=N2)S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)