CAS 1432682-11-5 appears in our catalog under these names: 5-Cyclopropyl-1-propyl-1H-pyrazol-4-amine hydrochloride, 95%, 5-Cyclopropyl-1-propyl-1H-pyrazol-4-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-cyclopropyl-1-propylpyrazol-4-amine;hydrochloride (CAS 1432682-11-5) is a chemical compound with the molecular formula C9H16ClN3 and a molecular weight of 201.70 g/mol. IUPAC name: 5-cyclopropyl-1-propylpyrazol-4-amine;hydrochloride. InChIKey: CLZGUGUJPTZEHT-UHFFFAOYSA-N.
| Molecular formula | C9H16ClN3 |
|---|---|
| Molecular weight | 201.70 g/mol |
| IUPAC name | 5-cyclopropyl-1-propylpyrazol-4-amine;hydrochloride |
| InChIKey | CLZGUGUJPTZEHT-UHFFFAOYSA-N |
| SMILES | CCCN1C(=C(C=N1)N)C2CC2.Cl |
Computed by PubChem (NCBI)