CAS 1432684-08-6 appears in our catalog under these names: 1-(1,2-Dichloro-2-phenylethenesulfonyl)piperazine, 98%, 1-(1,2-Dichloro-2-phenylethenesulfonyl)piperazine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[(E)-1,2-dichloro-2-phenylethenyl]sulfonylpiperazine (CAS 1432684-08-6) is a chemical compound with the molecular formula C12H14Cl2N2O2S and a molecular weight of 321.2 g/mol. IUPAC name: 1-[(E)-1,2-dichloro-2-phenylethenyl]sulfonylpiperazine. InChIKey: KNOPMIUVPFCVOG-QXMHVHEDSA-N.
| Molecular formula | C12H14Cl2N2O2S |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 1-[(E)-1,2-dichloro-2-phenylethenyl]sulfonylpiperazine |
| InChIKey | KNOPMIUVPFCVOG-QXMHVHEDSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)/C(=C(/C2=CC=CC=C2)\Cl)/Cl |
Computed by PubChem (NCBI)