CAS 1432684-10-0 appears in our catalog under these names: Potassium 1-cyano-5-methylhex-1-en-2-olate, 95%, Potassium 1-cyano-5-methylhex-1-en-2-olate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Potassium (Z)-1-cyano-5-methylhex-1-en-2-olate (CAS 1432684-10-0) is a chemical compound with the molecular formula C8H12KNO and a molecular weight of 177.29 g/mol. IUPAC name: potassium (Z)-1-cyano-5-methylhex-1-en-2-olate. InChIKey: HTILNBGUBBJTSK-HGKIGUAWSA-M.
| Molecular formula | C8H12KNO |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | potassium (Z)-1-cyano-5-methylhex-1-en-2-olate |
| InChIKey | HTILNBGUBBJTSK-HGKIGUAWSA-M |
| SMILES | CC(C)CC/C(=C/C#N)/[O-].[K+] |
Computed by PubChem (NCBI)