CAS 1432728-49-8 appears in our catalog under these names: mGluR2 antagonist 1, 7-[(2,5-Dioxo-1-pyrrolidinyl)methyl]-4-(4-fluorophenyl)-2-quinolinecarboxamide, 99.31%, 99.31%, mGluR2 antagonist 1, 99.31%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 5 mg, 50 mg.
7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-fluorophenyl)quinoline-2-carboxamide (CAS 1432728-49-8) is a chemical compound with the molecular formula C21H16FN3O3 and a molecular weight of 377.4 g/mol. IUPAC name: 7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-fluorophenyl)quinoline-2-carboxamide. InChIKey: XSTBUOHORFUCIB-UHFFFAOYSA-N.
| Molecular formula | C21H16FN3O3 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-fluorophenyl)quinoline-2-carboxamide |
| InChIKey | XSTBUOHORFUCIB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)CC2=CC3=C(C=C2)C(=CC(=N3)C(=O)N)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)