Products 1432738-00-5
CAS 1432738-00-5 is the registry number for AChE/BChE/MAO-B-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]isoindole-1,3-dione (CAS 1432738-00-5) is a chemical compound with the molecular formula C22H14F3NO2 and a molecular weight of 381.3 g/mol. IUPAC name: 2-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]isoindole-1,3-dione. InChIKey: DBCOCUPRPXORSW-UHFFFAOYSA-N.
| Molecular formula | C22H14F3NO2 |
|---|---|
| Molecular weight | 381.3 g/mol |
| IUPAC name | 2-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]isoindole-1,3-dione |
| InChIKey | DBCOCUPRPXORSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC=C(C=C3)C4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)