Products 1432795-16-8

CAS 1432795-16-8 appears in our catalog under these names: 3,5-Dichloro-4-(trifluoromethyl)aniline hydrochloride, 95%, 3,5-Dichloro-4-(trifluoromethyl)aniline hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-(trifluoromethyl)aniline;hydrochloride (CAS 1432795-16-8) is a chemical compound with the molecular formula C7H5Cl3F3N and a molecular weight of 266.5 g/mol. IUPAC name: 3,5-dichloro-4-(trifluoromethyl)aniline;hydrochloride. InChIKey: WSHOOXPXZLCDQY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl3F3N
Molecular weight266.5 g/mol
IUPAC name3,5-dichloro-4-(trifluoromethyl)aniline;hydrochloride
InChIKeyWSHOOXPXZLCDQY-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)C(F)(F)F)Cl)N.Cl

Computed by PubChem (NCBI)