CAS 1432795-16-8 appears in our catalog under these names: 3,5-Dichloro-4-(trifluoromethyl)aniline hydrochloride, 95%, 3,5-Dichloro-4-(trifluoromethyl)aniline hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3,5-dichloro-4-(trifluoromethyl)aniline;hydrochloride (CAS 1432795-16-8) is a chemical compound with the molecular formula C7H5Cl3F3N and a molecular weight of 266.5 g/mol. IUPAC name: 3,5-dichloro-4-(trifluoromethyl)aniline;hydrochloride. InChIKey: WSHOOXPXZLCDQY-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl3F3N |
|---|---|
| Molecular weight | 266.5 g/mol |
| IUPAC name | 3,5-dichloro-4-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | WSHOOXPXZLCDQY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(F)(F)F)Cl)N.Cl |
Computed by PubChem (NCBI)