CAS 1433206-26-8 is the registry number for 2-Chloro-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pyrimidine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(2-chloropyrimidin-5-yl)-5-(trifluoromethyl)-1,2,4-oxadiazole (CAS 1433206-26-8) is a chemical compound with the molecular formula C7H2ClF3N4O and a molecular weight of 250.56 g/mol. IUPAC name: 3-(2-chloropyrimidin-5-yl)-5-(trifluoromethyl)-1,2,4-oxadiazole. InChIKey: QLBGHVOEHFVULX-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N4O |
|---|---|
| Molecular weight | 250.56 g/mol |
| IUPAC name | 3-(2-chloropyrimidin-5-yl)-5-(trifluoromethyl)-1,2,4-oxadiazole |
| InChIKey | QLBGHVOEHFVULX-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)Cl)C2=NOC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)