CAS 1433216-71-7 is the registry number for Pyrifluquinazon metabolite IV-203. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg.
6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-quinazoline-2,4-dione (CAS 1433216-71-7) is a chemical compound with the molecular formula C11H5F7N2O2 and a molecular weight of 330.16 g/mol. IUPAC name: 6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-quinazoline-2,4-dione. InChIKey: DSYILADFGBXVIH-UHFFFAOYSA-N.
| Molecular formula | C11H5F7N2O2 |
|---|---|
| Molecular weight | 330.16 g/mol |
| IUPAC name | 6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-quinazoline-2,4-dione |
| InChIKey | DSYILADFGBXVIH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(C(F)(F)F)(C(F)(F)F)F)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)