CAS 143322-46-7 is the registry number for (R)-Benzyl 2-((5-bromo-1H-indol-3-yl)methyl)pyrrolidine-1-carboxylate. Offered by: TRC. Available pack sizes: 250mg.
Benzyl (2R)-2-[(5-bromo-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylate (CAS 143322-46-7) is a chemical compound with the molecular formula C21H21BrN2O2 and a molecular weight of 413.3 g/mol. IUPAC name: benzyl (2R)-2-[(5-bromo-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylate. InChIKey: ICTXUHGADAKYDZ-GOSISDBHSA-N.
| Molecular formula | C21H21BrN2O2 |
|---|---|
| Molecular weight | 413.3 g/mol |
| IUPAC name | benzyl (2R)-2-[(5-bromo-1H-indol-3-yl)methyl]pyrrolidine-1-carboxylate |
| InChIKey | ICTXUHGADAKYDZ-GOSISDBHSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)CC3=CNC4=C3C=C(C=C4)Br |
Computed by PubChem (NCBI)