CAS 143323-55-1 is the registry number for L-012, 99.63%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg.
8-amino-5-chloro-7-phenyl-2,3-dihydropyrido[3,4-d]pyridazine-1,4-dione (CAS 143323-55-1) is a chemical compound with the molecular formula C13H9ClN4O2 and a molecular weight of 288.69 g/mol. IUPAC name: 8-amino-5-chloro-7-phenyl-2,3-dihydropyrido[3,4-d]pyridazine-1,4-dione. InChIKey: ABEDICJFYSFCHB-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN4O2 |
|---|---|
| Molecular weight | 288.69 g/mol |
| IUPAC name | 8-amino-5-chloro-7-phenyl-2,3-dihydropyrido[3,4-d]pyridazine-1,4-dione |
| InChIKey | ABEDICJFYSFCHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=C(C(=O)NNC3=O)C(=N2)Cl)N |
Computed by PubChem (NCBI)