CAS 14337-31-6 is the registry number for 2,2,2-Trichloro-1-(4-methoxyphenyl)ethanol. Offered by: TRC. Available pack sizes: 5g.
2,2,2-trichloro-1-(4-methoxyphenyl)ethanol (CAS 14337-31-6) is a chemical compound with the molecular formula C9H9Cl3O2 and a molecular weight of 255.5 g/mol. IUPAC name: 2,2,2-trichloro-1-(4-methoxyphenyl)ethanol. InChIKey: DQMIPRIVNVYSDB-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl3O2 |
|---|---|
| Molecular weight | 255.5 g/mol |
| IUPAC name | 2,2,2-trichloro-1-(4-methoxyphenyl)ethanol |
| InChIKey | DQMIPRIVNVYSDB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(Cl)(Cl)Cl)O |
Computed by PubChem (NCBI)