Products 1433990-38-5
CAS 1433990-38-5 is the registry number for tert-Butyl 3,3-dimethyl-4-(6-nitropyridin-3-yl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3,3-dimethyl-4-(6-nitro-3-pyridinyl)piperazine-1-carboxylate (CAS 1433990-38-5) is a chemical compound with the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. IUPAC name: tert-butyl 3,3-dimethyl-4-(6-nitro-3-pyridinyl)piperazine-1-carboxylate. InChIKey: UGHSOIKWUFSYOZ-UHFFFAOYSA-N.
| Molecular formula | C16H24N4O4 |
|---|---|
| Molecular weight | 336.39 g/mol |
| IUPAC name | tert-butyl 3,3-dimethyl-4-(6-nitro-3-pyridinyl)piperazine-1-carboxylate |
| InChIKey | UGHSOIKWUFSYOZ-UHFFFAOYSA-N |
| SMILES | CC1(CN(CCN1C2=CN=C(C=C2)[N+](=O)[O-])C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)