CAS 143413-36-9 is the registry number for Leu-trp-ome hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 143413-36-9) is a chemical compound with the molecular formula C18H26ClN3O3 and a molecular weight of 367.9 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: UWXXREJDKHROOB-DMLYUBSXSA-N.
| Molecular formula | C18H26ClN3O3 |
|---|---|
| Molecular weight | 367.9 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | UWXXREJDKHROOB-DMLYUBSXSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)