CAS 143435-52-3 appears in our catalog under these names: 1,3,5-Trihydroxyhexahydro-1,3,5-triazine-2,4,6-trione, 95%, 1,3,5-Trihydroxy-1,3,5-triazinane-2,4,6-trione, 1,3,5-Trihydroxyhexahydro-1,3,5-triazine-2,4,6-trione, 97%, 97%, 1,3,5-Trihydroxy-1,3,5-triazinane-2,4,6-trione, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100mg, 25mg, 250mg, 1000mg.
1,3,5-trihydroxy-1,3,5-triazinane-2,4,6-trione (CAS 143435-52-3) is a chemical compound with the molecular formula C3H3N3O6 and a molecular weight of 177.07 g/mol. IUPAC name: 1,3,5-trihydroxy-1,3,5-triazinane-2,4,6-trione. InChIKey: NBIJDQIBCRZHFK-UHFFFAOYSA-N.
| Molecular formula | C3H3N3O6 |
|---|---|
| Molecular weight | 177.07 g/mol |
| IUPAC name | 1,3,5-trihydroxy-1,3,5-triazinane-2,4,6-trione |
| InChIKey | NBIJDQIBCRZHFK-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C(=O)N(C(=O)N1O)O)O |
Computed by PubChem (NCBI)