CAS 1434445-10-9 is the registry number for Boc-L-Tyr(2-azidoethyl)-OH. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: on request, Get quote.
(2S)-3-[4-(2-azidoethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1434445-10-9) is a chemical compound with the molecular formula C16H22N4O5 and a molecular weight of 350.37 g/mol. IUPAC name: (2S)-3-[4-(2-azidoethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: FGIIXSNUBTXDMU-ZDUSSCGKSA-N.
| Molecular formula | C16H22N4O5 |
|---|---|
| Molecular weight | 350.37 g/mol |
| IUPAC name | (2S)-3-[4-(2-azidoethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | FGIIXSNUBTXDMU-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)