CAS 1434643-33-0 appears in our catalog under these names: CS-B1628, 98%, CS-B1628/ 98.94% (existing batch purity), CS-B1628, 96%, 96%, tert-Butyl 2-(6-bromo-5-methyl-2,4-dioxo-1,4-dihydrothieno[2,3-d]pyrimidin-3(2H)-yl)-2-methylpropanoate, 96%. Offered by: AmBeed, TargetMol, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl 2-(6-bromo-5-methyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)-2-methylpropanoate (CAS 1434643-33-0) is a chemical compound with the molecular formula C15H19BrN2O4S and a molecular weight of 403.3 g/mol. IUPAC name: tert-butyl 2-(6-bromo-5-methyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)-2-methylpropanoate. InChIKey: APGNVOSIXZYEPK-UHFFFAOYSA-N.
| Molecular formula | C15H19BrN2O4S |
|---|---|
| Molecular weight | 403.3 g/mol |
| IUPAC name | tert-butyl 2-(6-bromo-5-methyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)-2-methylpropanoate |
| InChIKey | APGNVOSIXZYEPK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)N(C(=O)N2)C(C)(C)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)