CAS 1434650-42-6 is the registry number for Benzyl 3-(tert-butyl(dimethyl)silyl)oxyazetidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Benzyl 3-[tert-butyl(dimethyl)silyl]oxyazetidine-1-carboxylate (CAS 1434650-42-6) is a chemical compound with the molecular formula C17H27NO3Si and a molecular weight of 321.5 g/mol. IUPAC name: benzyl 3-[tert-butyl(dimethyl)silyl]oxyazetidine-1-carboxylate. InChIKey: CWGNHRHKWPAPHE-UHFFFAOYSA-N.
| Molecular formula | C17H27NO3Si |
|---|---|
| Molecular weight | 321.5 g/mol |
| IUPAC name | benzyl 3-[tert-butyl(dimethyl)silyl]oxyazetidine-1-carboxylate |
| InChIKey | CWGNHRHKWPAPHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CN(C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)