CAS 14348-23-3 is the registry number for 5,8-Dihydroxypsoralen. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 25mg, 10mg, 50mg, 250mg, Get quote.
4,9-dihydroxyfuro[3,2-g]chromen-7-one (CAS 14348-23-3) is a chemical compound with the molecular formula C11H6O5 and a molecular weight of 218.16 g/mol. IUPAC name: 4,9-dihydroxyfuro[3,2-g]chromen-7-one. InChIKey: DZEPISXWRUMGFN-UHFFFAOYSA-N.
| Molecular formula | C11H6O5 |
|---|---|
| Molecular weight | 218.16 g/mol |
| IUPAC name | 4,9-dihydroxyfuro[3,2-g]chromen-7-one |
| InChIKey | DZEPISXWRUMGFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)OC2=C(C3=C(C=CO3)C(=C21)O)O |
Computed by PubChem (NCBI)