Products 143485-05-6
CAS 143485-05-6 appears in our catalog under these names: 7’-O-DMT-morpholino thymine, 7'-O-DMT-morpholino thymine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 2g, 0,5g, 10 mg, 5 mg, 25 mg, 100 mg, 50 mg.
1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione (CAS 143485-05-6) is a chemical compound with the molecular formula C31H33N3O6 and a molecular weight of 543.6 g/mol. IUPAC name: 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: RPBDWQROLYXOSD-WUFINQPMSA-N.
| Molecular formula | C31H33N3O6 |
|---|---|
| Molecular weight | 543.6 g/mol |
| IUPAC name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | RPBDWQROLYXOSD-WUFINQPMSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2CNC[C@H](O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |
Computed by PubChem (NCBI)