CAS 14353-86-7 is the registry number for Tris(trifluoroacetoxy)iodine. Offered by: TRC, Biosynth. Available pack sizes: 1g, 500mg, 250mg.
[bis[(2,2,2-trifluoroacetyl)oxy]-lambda3-iodanyl] 2,2,2-trifluoroacetate (CAS 14353-86-7) is a chemical compound with the molecular formula C6F9IO6 and a molecular weight of 465.95 g/mol. IUPAC name: [bis[(2,2,2-trifluoroacetyl)oxy]-lambda3-iodanyl] 2,2,2-trifluoroacetate. InChIKey: LLKSJVKRWAPXNE-UHFFFAOYSA-N.
| Molecular formula | C6F9IO6 |
|---|---|
| Molecular weight | 465.95 g/mol |
| IUPAC name | [bis[(2,2,2-trifluoroacetyl)oxy]-lambda3-iodanyl] 2,2,2-trifluoroacetate |
| InChIKey | LLKSJVKRWAPXNE-UHFFFAOYSA-N |
| SMILES | C(=O)(C(F)(F)F)OI(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
Computed by PubChem (NCBI)