Products 143556-21-2

CAS 143556-21-2 is the registry number for DIETHYL 2-AMINO-6-PHENYLPYRIDINE-3,4-DICARBOXYLATE HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl 2-amino-6-phenylpyridine-3,4-dicarboxylate;hydrochloride (CAS 143556-21-2) is a chemical compound with the molecular formula C17H19ClN2O4 and a molecular weight of 350.8 g/mol. IUPAC name: diethyl 2-amino-6-phenylpyridine-3,4-dicarboxylate;hydrochloride. InChIKey: GOOINUCAMGGXOA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19ClN2O4
Molecular weight350.8 g/mol
IUPAC namediethyl 2-amino-6-phenylpyridine-3,4-dicarboxylate;hydrochloride
InChIKeyGOOINUCAMGGXOA-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=NC(=C1C(=O)OCC)N)C2=CC=CC=C2.Cl

Computed by PubChem (NCBI)