CAS 143556-24-5 appears in our catalog under these names: L 012 sodium salt, L 012 Sodium Salt, L 012 sodium salt/ 98.34% (existing batch purity), L 012 sodium salt 95%, L 012 Sodium Salt, 95%, 95%. Offered by: GLPBio, TRC, TargetMol, Ambeed, Chemat. Available pack sizes: 5mg, 500mg, 1mg, 10mg, 25mg, 50mg, 100mg, 25 mg.
Sodium 8-amino-5-chloro-1-oxo-7-phenyl-2H-pyrido[3,4-d]pyridazin-4-olate (CAS 143556-24-5) is a chemical compound with the molecular formula C13H8ClN4NaO2 and a molecular weight of 310.67 g/mol. IUPAC name: sodium 8-amino-5-chloro-1-oxo-7-phenyl-2H-pyrido[3,4-d]pyridazin-4-olate. InChIKey: IGEUYSJHQQCEFP-UHFFFAOYSA-M.
| Molecular formula | C13H8ClN4NaO2 |
|---|---|
| Molecular weight | 310.67 g/mol |
| IUPAC name | sodium 8-amino-5-chloro-1-oxo-7-phenyl-2H-pyrido[3,4-d]pyridazin-4-olate |
| InChIKey | IGEUYSJHQQCEFP-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=C(C3=C(C(=NNC3=O)[O-])C(=N2)Cl)N.[Na+] |
Computed by PubChem (NCBI)