CAS 1435804-53-7 is the registry number for ([3-(2-Fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride (CAS 1435804-53-7) is a chemical compound with the molecular formula C9H9ClFN3O and a molecular weight of 229.64 g/mol. IUPAC name: [3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride. InChIKey: ZFMRGLFHKIRASG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFN3O |
|---|---|
| Molecular weight | 229.64 g/mol |
| IUPAC name | [3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride |
| InChIKey | ZFMRGLFHKIRASG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)CN)F.Cl |
Computed by PubChem (NCBI)