CAS 1435806-88-4 appears in our catalog under these names: Boc-3-amino-2,2-difluoro-propionic acid potassium salt, 95%, Boc-beta-Ala(F2)-OK. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 1g, 250mg.
Potassium 2,2-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1435806-88-4) is a chemical compound with the molecular formula C8H12F2KNO4 and a molecular weight of 263.28 g/mol. IUPAC name: potassium 2,2-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: HOJUYQGYZGWWJZ-UHFFFAOYSA-M.
| Molecular formula | C8H12F2KNO4 |
|---|---|
| Molecular weight | 263.28 g/mol |
| IUPAC name | potassium 2,2-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | HOJUYQGYZGWWJZ-UHFFFAOYSA-M |
| SMILES | CC(C)(C)OC(=O)NCC(C(=O)[O-])(F)F.[K+] |
Computed by PubChem (NCBI)