CAS 1435972-52-3 appears in our catalog under these names: 2-((2-{((4-Nitrophenoxy)carbonyl)oxy}ethyl)disulfanyl)ethyl 4-nitrophenyl carbonate, Disulfanediylbis(ethane-2,1-diyl) bis(4-nitrophenyl) dicarbonate, 97%, pNCO-SS-OpNC. Offered by: TRC, AmBeed, Iris Biotech. Available pack sizes: 100mg, 5g, 250mg.
2-[2-(4-nitrophenoxy)carbonyloxyethyldisulfanyl]ethyl (4-nitrophenyl) carbonate (CAS 1435972-52-3) is a chemical compound with the molecular formula C18H16N2O10S2 and a molecular weight of 484.5 g/mol. IUPAC name: 2-[2-(4-nitrophenoxy)carbonyloxyethyldisulfanyl]ethyl (4-nitrophenyl) carbonate. InChIKey: QTUSWJNRRLOVAI-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O10S2 |
|---|---|
| Molecular weight | 484.5 g/mol |
| IUPAC name | 2-[2-(4-nitrophenoxy)carbonyloxyethyldisulfanyl]ethyl (4-nitrophenyl) carbonate |
| InChIKey | QTUSWJNRRLOVAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OCCSSCCOC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)