CAS 14365-45-8 appears in our catalog under these names: 2'-Deoxy-L-adenosine, 98%, 2’-Deoxy-Beta-L-adenosine, >95% (HPLC), 2’-Deoxy-beta-L-adenosine (May contain up to 20% inorganics), >95% (HPLC), 2'–Deoxy–L–adenosine, 2'-Deoxy-L-adenosine. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 25mg, 50mg, 1000mg, 500mg, 2000mg.
(2S,3R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 14365-45-8) is a chemical compound with the molecular formula C10H13N5O3 and a molecular weight of 251.24 g/mol. IUPAC name: (2S,3R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: OLXZPDWKRNYJJZ-DSYKOEDSSA-N.
| Molecular formula | C10H13N5O3 |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | (2S,3R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | OLXZPDWKRNYJJZ-DSYKOEDSSA-N |
| SMILES | C1[C@H]([C@@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)CO)O |
Computed by PubChem (NCBI)