CAS 14365-73-2 is the registry number for 1-Amino-1-deoxy-2,3,4-triacetate beta-D-Glucopyranuronic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 250mg.
Methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-aminooxane-2-carboxylate (CAS 14365-73-2) is a chemical compound with the molecular formula C13H19NO9 and a molecular weight of 333.29 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-aminooxane-2-carboxylate. InChIKey: PNVXGQJLIHLVLH-HHHUOAJASA-N.
| Molecular formula | C13H19NO9 |
|---|---|
| Molecular weight | 333.29 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-aminooxane-2-carboxylate |
| InChIKey | PNVXGQJLIHLVLH-HHHUOAJASA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)N)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)