CAS 1436920-57-8 is the registry number for Tapencarium. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride (CAS 1436920-57-8) is a chemical compound with the molecular formula C20H25Br2ClN2 and a molecular weight of 488.7 g/mol. IUPAC name: 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride. InChIKey: GYDHQSBIPOHCIM-UHFFFAOYSA-M.
| Molecular formula | C20H25Br2ClN2 |
|---|---|
| Molecular weight | 488.7 g/mol |
| IUPAC name | 5-(3,6-dibromocarbazol-9-yl)pentyl-trimethylazanium chloride |
| InChIKey | GYDHQSBIPOHCIM-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCCCCN1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br.[Cl-] |
Computed by PubChem (NCBI)