CAS 143722-25-2 appears in our catalog under these names: 2-(2-Trityl-2H-tetrazol-5-yl)phenylboronic Acid, [2-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenyl]boronic acid, 98%, (2-(2-Trityl-2H-tetrazol-5-yl)phenyl)boronic acid, 97%. Offered by: TRC, Combi-blocks, AmBeed. Available pack sizes: 250mg, 25mg, 5g, 1g.
[2-(2-trityltetrazol-5-yl)phenyl]boronic acid (CAS 143722-25-2) is a chemical compound with the molecular formula C26H21BN4O2 and a molecular weight of 432.3 g/mol. IUPAC name: [2-(2-trityltetrazol-5-yl)phenyl]boronic acid. InChIKey: LFUCLSFLKKJFQH-UHFFFAOYSA-N.
| Molecular formula | C26H21BN4O2 |
|---|---|
| Molecular weight | 432.3 g/mol |
| IUPAC name | [2-(2-trityltetrazol-5-yl)phenyl]boronic acid |
| InChIKey | LFUCLSFLKKJFQH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=NN(N=N2)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)(O)O |
Computed by PubChem (NCBI)