CAS 143724-69-0 appears in our catalog under these names: Kaempferol 3,4',7-triacetate/ 99.03% (existing batch purity), Kaempferol 3,4,7-triacetate, Kaempferol 3,4',7-triacetate, 99.83%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 20mg, 5 mg.
[4-(3,7-diacetyloxy-5-hydroxy-4-oxochromen-2-yl)phenyl] acetate (CAS 143724-69-0) is a chemical compound with the molecular formula C21H16O9 and a molecular weight of 412.3 g/mol. IUPAC name: [4-(3,7-diacetyloxy-5-hydroxy-4-oxochromen-2-yl)phenyl] acetate. InChIKey: DJKUFDVJACBQPB-UHFFFAOYSA-N.
| Molecular formula | C21H16O9 |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | [4-(3,7-diacetyloxy-5-hydroxy-4-oxochromen-2-yl)phenyl] acetate |
| InChIKey | DJKUFDVJACBQPB-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC(=O)C)O)OC(=O)C |
Computed by PubChem (NCBI)